![[ICO]](/icons/blank.gif){kind=icon}
![[DIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/compressed.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Искусствен..> | 10-Sep-2018 02:17 | 145K | |
| 2018ai_webb.pdf | 10-Sep-2018 02:07 | 845K | |
| AI Taiwan.pdf | 10-Sep-2018 02:07 | 116K | |
| AIforVietnamTT.pptx | 10-Sep-2018 02:14 | 59M | |
| AI in the Nordic-Bal..> | 10-Sep-2018 02:07 | 65K | |
| AIstrategies.docx | 10-Sep-2018 02:07 | 122K | |
| A Next Generation Ar..> | 10-Sep-2018 02:07 | 366K | |
| An Overview of Natio..> | 10-Sep-2018 02:07 | 2.1M | |
| Archive.zip | 10-Sep-2018 02:15 | 75M | |
| Budget 2018: Governm..> | 10-Sep-2018 02:14 | 452K | |
| Deutscher Bundestag ..> | 10-Sep-2018 02:14 | 106K | |
| Digital growth strat..> | 10-Sep-2018 02:14 | 3.9M | |
| EU-CommunicationArti..> | 10-Sep-2018 02:14 | 420K | |
| FinlandAIstrategy.pdf | 10-Sep-2018 02:14 | 745K | |
| GẻmanyAI - Smart S..> | 10-Sep-2018 02:15 | 111K | |
| Germany4.0.pdf | 10-Sep-2018 02:15 | 4.5M | |
| India NationalStrate..> | 10-Sep-2018 02:15 | 4.0M | |
| Japan-AIstrategy.pdf | 10-Sep-2018 02:16 | 6.8M | |
| Key points of the Fe..> | 10-Sep-2018 02:15 | 108K | |
| Korea-AI.docx | 10-Sep-2018 02:15 | 109K | |
| Korea-AI.pdf | 10-Sep-2018 02:15 | 3.4M | |
| MexicoAI.pdf | 10-Sep-2018 02:16 | 835K | |
| MissionVillani_Repor..> | 10-Sep-2018 02:16 | 1.7M | |
| National AI Strategy..> | 10-Sep-2018 02:16 | 313K | |
| New Zealand examinin..> | 10-Sep-2018 02:16 | 138K | |
| Những điểm chí..> | 10-Sep-2018 02:16 | 112K | |
| Pan-Canadian Artific..> | 10-Sep-2018 02:16 | 755K | |
| Public-Private Dialo..> | 10-Sep-2018 02:16 | 656K | |
| Tổng quan chiến ..> | 10-Sep-2018 02:16 | 15K | |
| Trí tuệ nhân t..> | 10-Sep-2018 02:16 | 88K | |
| Translation_ Chinese..> | 10-Sep-2018 02:16 | 5.0M | |
| UAE Strategy for Art..> | 10-Sep-2018 02:16 | 110K | |
| UK-AI.pdf | 10-Sep-2018 02:16 | 1.0M | |
| UK-AI2.pdf | 10-Sep-2018 02:16 | 2.3M | |
| US-AI-Summit.pdf | 10-Sep-2018 02:16 | 1.9M | |
| USA-preparing_for_th..> | 10-Sep-2018 02:16 | 1.2M | |
| US Artificial-Intell..> | 10-Sep-2018 02:16 | 1.2M | |
| USITO _ Three Year A..> | 10-Sep-2018 02:16 | 87K | |
| USnational_ai_rd_str..> | 10-Sep-2018 02:17 | 1.8M | |
| Welcome to OpenGovAs..> | 10-Sep-2018 02:17 | 8.8M | |
| eckpunktepapier-ki.pdf | 10-Sep-2018 02:14 | 179K | |
| report-ethics-commis..> | 10-Sep-2018 02:16 | 461K | |